C21H30O3 — CID 100917126
undec-10-enyl (E)-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 100917126) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is undec-10-enyl (E)-3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | undec-10-enyl (E)-3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 100917126 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | undec-10-enyl (E)-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | C=CCCCCCCCCCOC(=O)/C=C/c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H30O3/c1-3-4-5-6-7-8-9-10-11-18-24-21(22)17-14-19-12-15-20(23-2)16-13-19/h3,12-17H,1,4-11,18H2,2H3/b17-14+ |
| InChIKey | VANUNKCHDVNZQK-SAPNQHFASA-N |
| XLogP | 5.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|