C20H26O5 — CID 134454514
6-prop-2-enoyloxyhexyl (E)-3-(4-ethoxyphenyl)prop-2-enoate (PubChem CID 134454514) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is 6-prop-2-enoyloxyhexyl (E)-3-(4-ethoxyphenyl)prop-2-enoate.
| Compound Name | 6-prop-2-enoyloxyhexyl (E)-3-(4-ethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 134454514 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 6-prop-2-enoyloxyhexyl (E)-3-(4-ethoxyphenyl)prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOC(=O)/C=C/c1ccc(OCC)cc1 |
| InChI | InChI=1S/C20H26O5/c1-3-19(21)24-15-7-5-6-8-16-25-20(22)14-11-17-9-12-18(13-10-17)23-4-2/h3,9-14H,1,4-8,15-16H2,2H3/b14-11+ |
| InChIKey | ISGGCQAADISMQE-SDNWHVSQSA-N |
| XLogP | 3.93 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|