C17H24O5 — CID 145059918
6-(4-formylphenoxy)hexyl prop-2-enoate;methanol (PubChem CID 145059918) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is 6-(4-formylphenoxy)hexyl prop-2-enoate;methanol.
| Compound Name | 6-(4-formylphenoxy)hexyl prop-2-enoate;methanol |
|---|---|
| PubChem CID | 145059918 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 6-(4-formylphenoxy)hexyl prop-2-enoate;methanol |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C=O)cc1.CO |
| InChI | InChI=1S/C16H20O4.CH4O/c1-2-16(18)20-12-6-4-3-5-11-19-15-9-7-14(13-17)8-10-15;1-2/h2,7-10,13H,1,3-6,11-12H2;2H,1H3 |
| InChIKey | FLVPUXNAWVFQKY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|