C32H45NO4 — CID 102071844
6-[4-[(4-decoxyphenyl)iminomethyl]phenoxy]hexyl prop-2-enoate (PubChem CID 102071844) has the molecular formula C32H45NO4 and a molecular weight of 507.72 g/mol. Its IUPAC name is 6-[4-[(4-decoxyphenyl)iminomethyl]phenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[4-[(4-decoxyphenyl)iminomethyl]phenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 102071844 |
| Molecular Formula | C32H45NO4 |
| Molecular Weight | 507.72 g/mol |
| Exact Mass | 507.33 |
| IUPAC Name | 6-[4-[(4-decoxyphenyl)iminomethyl]phenoxy]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(/C=N/c2ccc(OCCCCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C32H45NO4/c1-3-5-6-7-8-9-10-13-24-36-31-22-18-29(19-23-31)33-27-28-16-20-30(21-17-28)35-25-14-11-12-15-26-37-32(34)4-2/h4,16-23,27H,2-3,5-15,24-26H2,1H3/b33-27+ |
| InChIKey | PFHRHLKXOUQFIQ-MUGXBBEHSA-N |
| XLogP | 8.63 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.72 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|