C21H25NO3 — CID 43836038
4-[(4-heptoxyphenyl)methylideneamino]benzoic acid (PubChem CID 43836038) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is 4-[(4-heptoxyphenyl)methylideneamino]benzoic acid.
| Compound Name | 4-[(4-heptoxyphenyl)methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 43836038 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 4-[(4-heptoxyphenyl)methylideneamino]benzoic acid |
| SMILES | CCCCCCCOc1ccc(/C=N/c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C21H25NO3/c1-2-3-4-5-6-15-25-20-13-7-17(8-14-20)16-22-19-11-9-18(10-12-19)21(23)24/h7-14,16H,2-6,15H2,1H3,(H,23,24)/b22-16+ |
| InChIKey | NPVHJKPYGZUIOB-CJLVFECKSA-N |
| XLogP | 5.48 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|