C54H56N2O8 — CID 102027755
[4-[[4-[2-[4-[[4-(4-hexoxybenzoyl)oxyphenyl]methylideneamino]phenoxy]ethoxy]phenyl]iminomethyl]phenyl] 4-hexoxybenzoate (PubChem CID 102027755) has the molecular formula C54H56N2O8 and a molecular weight of 861.05 g/mol. Its IUPAC name is [4-[[4-[2-[4-[[4-(4-hexoxybenzoyl)oxyphenyl]methylideneamino]phenoxy]ethoxy]phenyl]iminomethyl]phenyl] 4-hexoxybenzoate.
| Compound Name | [4-[[4-[2-[4-[[4-(4-hexoxybenzoyl)oxyphenyl]methylideneamino]phenoxy]ethoxy]phenyl]iminomethyl]phenyl] 4-hexoxybenzoate |
|---|---|
| PubChem CID | 102027755 |
| Molecular Formula | C54H56N2O8 |
| Molecular Weight | 861.05 g/mol |
| Exact Mass | 860.40 |
| IUPAC Name | [4-[[4-[2-[4-[[4-(4-hexoxybenzoyl)oxyphenyl]methylideneamino]phenoxy]ethoxy]phenyl]iminomethyl]phenyl] 4-hexoxybenzoate |
| SMILES | CCCCCCOc1ccc(C(=O)Oc2ccc(/C=N/c3ccc(OCCOc4ccc(/N=C/c5ccc(OC(=O)c6ccc(OCCCCCC)cc6)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C54H56N2O8/c1-3-5-7-9-35-59-47-27-15-43(16-28-47)53(57)63-51-23-11-41(12-24-51)39-55-45-19-31-49(32-20-45)61-37-38-62-50-33-21-46(22-34-50)56-40-42-13-25-52(26-14-42)64-54(58)44-17-29-48(30-18-44)60-36-10-8-6-4-2/h11-34,39-40H,3-10,35-38H2,1-2H3/b55-39+,56-40+ |
| InChIKey | QSBCUIVUSDDOSH-FVBLWZQFSA-N |
| XLogP | 13.00 |
| TPSA | 114.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.05 |
| LogP ≤ 5 | 13.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|