C25H24ClNO3 — CID 4071198
[4-[(4-chlorophenyl)methylideneamino]phenyl] 4-pentoxybenzoate (PubChem CID 4071198) has the molecular formula C25H24ClNO3 and a molecular weight of 421.92 g/mol. Its IUPAC name is [4-[(4-chlorophenyl)methylideneamino]phenyl] 4-pentoxybenzoate.
| Compound Name | [4-[(4-chlorophenyl)methylideneamino]phenyl] 4-pentoxybenzoate |
|---|---|
| PubChem CID | 4071198 |
| Molecular Formula | C25H24ClNO3 |
| Molecular Weight | 421.92 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | [4-[(4-chlorophenyl)methylideneamino]phenyl] 4-pentoxybenzoate |
| SMILES | CCCCCOc1ccc(C(=O)Oc2ccc(/N=C/c3ccc(Cl)cc3)cc2)cc1 |
| InChI | InChI=1S/C25H24ClNO3/c1-2-3-4-17-29-23-13-7-20(8-14-23)25(28)30-24-15-11-22(12-16-24)27-18-19-5-9-21(26)10-6-19/h5-16,18H,2-4,17H2,1H3/b27-18+ |
| InChIKey | LQBDNIAFEFTHHV-OVVQPSECSA-N |
| XLogP | 6.88 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.92 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|