C28H32N2O3 — CID 101361121
[4-[[4-(dimethylamino)phenyl]methylideneamino]phenyl] 4-hexoxybenzoate (PubChem CID 101361121) has the molecular formula C28H32N2O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is [4-[[4-(dimethylamino)phenyl]methylideneamino]phenyl] 4-hexoxybenzoate.
| Compound Name | [4-[[4-(dimethylamino)phenyl]methylideneamino]phenyl] 4-hexoxybenzoate |
|---|---|
| PubChem CID | 101361121 |
| Molecular Formula | C28H32N2O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | [4-[[4-(dimethylamino)phenyl]methylideneamino]phenyl] 4-hexoxybenzoate |
| SMILES | CCCCCCOc1ccc(C(=O)Oc2ccc(/N=C/c3ccc(N(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H32N2O3/c1-4-5-6-7-20-32-26-16-10-23(11-17-26)28(31)33-27-18-12-24(13-19-27)29-21-22-8-14-25(15-9-22)30(2)3/h8-19,21H,4-7,20H2,1-3H3/b29-21+ |
| InChIKey | SBNBLABDWFNVAG-XHLNEMQHSA-N |
| XLogP | 6.68 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|