C61H70N2O6 — CID 102596585
[4-[[4-[4-[(4-decoxyphenyl)iminomethyl]benzoyl]oxyphenyl]methyl]phenyl] 4-[(4-decoxyphenyl)iminomethyl]benzoate (PubChem CID 102596585) has the molecular formula C61H70N2O6 and a molecular weight of 927.24 g/mol. Its IUPAC name is [4-[[4-[4-[(4-decoxyphenyl)iminomethyl]benzoyl]oxyphenyl]methyl]phenyl] 4-[(4-decoxyphenyl)iminomethyl]benzoate.
| Compound Name | [4-[[4-[4-[(4-decoxyphenyl)iminomethyl]benzoyl]oxyphenyl]methyl]phenyl] 4-[(4-decoxyphenyl)iminomethyl]benzoate |
|---|---|
| PubChem CID | 102596585 |
| Molecular Formula | C61H70N2O6 |
| Molecular Weight | 927.24 g/mol |
| Exact Mass | 926.52 |
| IUPAC Name | [4-[[4-[4-[(4-decoxyphenyl)iminomethyl]benzoyl]oxyphenyl]methyl]phenyl] 4-[(4-decoxyphenyl)iminomethyl]benzoate |
| SMILES | CCCCCCCCCCOc1ccc(/N=C/c2ccc(C(=O)Oc3ccc(Cc4ccc(OC(=O)c5ccc(/C=N/c6ccc(OCCCCCCCCCC)cc6)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C61H70N2O6/c1-3-5-7-9-11-13-15-17-43-66-56-39-31-54(32-40-56)62-46-50-19-27-52(28-20-50)60(64)68-58-35-23-48(24-36-58)45-49-25-37-59(38-26-49)69-61(65)53-29-21-51(22-30-53)47-63-55-33-41-57(42-34-55)67-44-18-16-14-12-10-8-6-4-2/h19-42,46-47H,3-18,43-45H2,1-2H3/b62-46+,63-47+ |
| InChIKey | DGSUSWTZHAEJNW-LALSNGOJSA-N |
| XLogP | 16.26 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 927.24 |
| LogP ≤ 5 | 16.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|