C54H64N2O6 — CID 101148419
[4-[[3-[[4-(4-decoxybenzoyl)oxyphenyl]methylideneamino]phenyl]iminomethyl]phenyl] 4-decoxybenzoate (PubChem CID 101148419) has the molecular formula C54H64N2O6 and a molecular weight of 837.11 g/mol. Its IUPAC name is [4-[[3-[[4-(4-decoxybenzoyl)oxyphenyl]methylideneamino]phenyl]iminomethyl]phenyl] 4-decoxybenzoate.
| Compound Name | [4-[[3-[[4-(4-decoxybenzoyl)oxyphenyl]methylideneamino]phenyl]iminomethyl]phenyl] 4-decoxybenzoate |
|---|---|
| PubChem CID | 101148419 |
| Molecular Formula | C54H64N2O6 |
| Molecular Weight | 837.11 g/mol |
| Exact Mass | 836.48 |
| IUPAC Name | [4-[[3-[[4-(4-decoxybenzoyl)oxyphenyl]methylideneamino]phenyl]iminomethyl]phenyl] 4-decoxybenzoate |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)Oc2ccc(/C=N/c3cccc(/N=C/c4ccc(OC(=O)c5ccc(OCCCCCCCCCC)cc5)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C54H64N2O6/c1-3-5-7-9-11-13-15-17-38-59-49-34-26-45(27-35-49)53(57)61-51-30-22-43(23-31-51)41-55-47-20-19-21-48(40-47)56-42-44-24-32-52(33-25-44)62-54(58)46-28-36-50(37-29-46)60-39-18-16-14-12-10-8-6-4-2/h19-37,40-42H,3-18,38-39H2,1-2H3/b55-41+,56-42+ |
| InChIKey | MOOHBMLHHXFEDW-KOUNKJJWSA-N |
| XLogP | 14.67 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.11 |
| LogP ≤ 5 | 14.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|