C24H22INO3 — CID 101016344
[4-[(3-iodophenyl)iminomethyl]phenyl] 4-butoxybenzoate (PubChem CID 101016344) has the molecular formula C24H22INO3 and a molecular weight of 499.35 g/mol. Its IUPAC name is [4-[(3-iodophenyl)iminomethyl]phenyl] 4-butoxybenzoate.
| Compound Name | [4-[(3-iodophenyl)iminomethyl]phenyl] 4-butoxybenzoate |
|---|---|
| PubChem CID | 101016344 |
| Molecular Formula | C24H22INO3 |
| Molecular Weight | 499.35 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | [4-[(3-iodophenyl)iminomethyl]phenyl] 4-butoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)Oc2ccc(/C=N/c3cccc(I)c3)cc2)cc1 |
| InChI | InChI=1S/C24H22INO3/c1-2-3-15-28-22-13-9-19(10-14-22)24(27)29-23-11-7-18(8-12-23)17-26-21-6-4-5-20(25)16-21/h4-14,16-17H,2-3,15H2,1H3/b26-17+ |
| InChIKey | NGBGVAQGRBPUJZ-YZSQISJMSA-N |
| XLogP | 6.44 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.35 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|