C66H72N6O6 — CID 102302528
[4-[(4-decoxyphenyl)diazenyl]phenyl] 4-[[3-[[4-[4-[(4-decoxyphenyl)diazenyl]phenoxy]carbonylphenyl]methylideneamino]phenyl]iminomethyl]benzoate (PubChem CID 102302528) has the molecular formula C66H72N6O6 and a molecular weight of 1045.34 g/mol. Its IUPAC name is [4-[(4-decoxyphenyl)diazenyl]phenyl] 4-[[3-[[4-[4-[(4-decoxyphenyl)diazenyl]phenoxy]carbonylphenyl]methylideneamino]phenyl]iminomethyl]benzoate.
| Compound Name | [4-[(4-decoxyphenyl)diazenyl]phenyl] 4-[[3-[[4-[4-[(4-decoxyphenyl)diazenyl]phenoxy]carbonylphenyl]methylideneamino]phenyl]iminomethyl]benzoate |
|---|---|
| PubChem CID | 102302528 |
| Molecular Formula | C66H72N6O6 |
| Molecular Weight | 1045.34 g/mol |
| Exact Mass | 1044.55 |
| IUPAC Name | [4-[(4-decoxyphenyl)diazenyl]phenyl] 4-[[3-[[4-[4-[(4-decoxyphenyl)diazenyl]phenoxy]carbonylphenyl]methylideneamino]phenyl]iminomethyl]benzoate |
| SMILES | CCCCCCCCCCOc1ccc(/N=N/c2ccc(OC(=O)c3ccc(/C=N/c4cccc(/N=C/c5ccc(C(=O)Oc6ccc(/N=N/c7ccc(OCCCCCCCCCC)cc7)cc6)cc5)c4)cc3)cc2)cc1 |
| InChI | InChI=1S/C66H72N6O6/c1-3-5-7-9-11-13-15-17-46-75-61-38-30-55(31-39-61)69-71-57-34-42-63(43-35-57)77-65(73)53-26-22-51(23-27-53)49-67-59-20-19-21-60(48-59)68-50-52-24-28-54(29-25-52)66(74)78-64-44-36-58(37-45-64)72-70-56-32-40-62(41-33-56)76-47-18-16-14-12-10-8-6-4-2/h19-45,48-50H,3-18,46-47H2,1-2H3/b67-49+,68-50+,71-69+,72-70+ |
| InChIKey | HXWCHMIQGOXIHE-LFTXAJMVSA-N |
| XLogP | 19.50 |
| TPSA | 145.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1045.34 |
| LogP ≤ 5 | 19.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|