C27H29NO3 — CID 101042818
(3-methylphenyl) 4-[(4-hexoxyphenyl)methylideneamino]benzoate (PubChem CID 101042818) has the molecular formula C27H29NO3 and a molecular weight of 415.53 g/mol. Its IUPAC name is (3-methylphenyl) 4-[(4-hexoxyphenyl)methylideneamino]benzoate.
| Compound Name | (3-methylphenyl) 4-[(4-hexoxyphenyl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 101042818 |
| Molecular Formula | C27H29NO3 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | (3-methylphenyl) 4-[(4-hexoxyphenyl)methylideneamino]benzoate |
| SMILES | CCCCCCOc1ccc(/C=N/c2ccc(C(=O)Oc3cccc(C)c3)cc2)cc1 |
| InChI | InChI=1S/C27H29NO3/c1-3-4-5-6-18-30-25-16-10-22(11-17-25)20-28-24-14-12-23(13-15-24)27(29)31-26-9-7-8-21(2)19-26/h7-17,19-20H,3-6,18H2,1-2H3/b28-20+ |
| InChIKey | BNNQKNNQUMJABD-VFCFBJKWSA-N |
| XLogP | 6.92 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|