C24H22ClNO3 — CID 101042832
(3-chlorophenyl) 4-[(4-butoxyphenyl)methylideneamino]benzoate (PubChem CID 101042832) has the molecular formula C24H22ClNO3 and a molecular weight of 407.90 g/mol. Its IUPAC name is (3-chlorophenyl) 4-[(4-butoxyphenyl)methylideneamino]benzoate.
| Compound Name | (3-chlorophenyl) 4-[(4-butoxyphenyl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 101042832 |
| Molecular Formula | C24H22ClNO3 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | (3-chlorophenyl) 4-[(4-butoxyphenyl)methylideneamino]benzoate |
| SMILES | CCCCOc1ccc(/C=N/c2ccc(C(=O)Oc3cccc(Cl)c3)cc2)cc1 |
| InChI | InChI=1S/C24H22ClNO3/c1-2-3-15-28-22-13-7-18(8-14-22)17-26-21-11-9-19(10-12-21)24(27)29-23-6-4-5-20(25)16-23/h4-14,16-17H,2-3,15H2,1H3/b26-17+ |
| InChIKey | VTQLKYIPLSPWFP-YZSQISJMSA-N |
| XLogP | 6.49 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|