C48H52N2O6 — CID 102158254
[4-[[4-[[4-(4-heptoxybenzoyl)oxyphenyl]iminomethyl]phenyl]methylideneamino]phenyl] 4-heptoxybenzoate (PubChem CID 102158254) has the molecular formula C48H52N2O6 and a molecular weight of 752.95 g/mol. Its IUPAC name is [4-[[4-[[4-(4-heptoxybenzoyl)oxyphenyl]iminomethyl]phenyl]methylideneamino]phenyl] 4-heptoxybenzoate.
| Compound Name | [4-[[4-[[4-(4-heptoxybenzoyl)oxyphenyl]iminomethyl]phenyl]methylideneamino]phenyl] 4-heptoxybenzoate |
|---|---|
| PubChem CID | 102158254 |
| Molecular Formula | C48H52N2O6 |
| Molecular Weight | 752.95 g/mol |
| Exact Mass | 752.38 |
| IUPAC Name | [4-[[4-[[4-(4-heptoxybenzoyl)oxyphenyl]iminomethyl]phenyl]methylideneamino]phenyl] 4-heptoxybenzoate |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(/N=C/c3ccc(/C=N/c4ccc(OC(=O)c5ccc(OCCCCCCC)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C48H52N2O6/c1-3-5-7-9-11-33-53-43-25-17-39(18-26-43)47(51)55-45-29-21-41(22-30-45)49-35-37-13-15-38(16-14-37)36-50-42-23-31-46(32-24-42)56-48(52)40-19-27-44(28-20-40)54-34-12-10-8-6-4-2/h13-32,35-36H,3-12,33-34H2,1-2H3/b49-35+,50-36+ |
| InChIKey | GJSLQJAFYXGCMS-YVXAEKBZSA-N |
| XLogP | 12.32 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.95 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|