C30H36N2O3 — CID 122390429
[4-[(4-octoxyphenyl)iminomethyl]phenyl] 4-(dimethylamino)benzoate (PubChem CID 122390429) has the molecular formula C30H36N2O3 and a molecular weight of 472.63 g/mol. Its IUPAC name is [4-[(4-octoxyphenyl)iminomethyl]phenyl] 4-(dimethylamino)benzoate.
| Compound Name | [4-[(4-octoxyphenyl)iminomethyl]phenyl] 4-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 122390429 |
| Molecular Formula | C30H36N2O3 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | [4-[(4-octoxyphenyl)iminomethyl]phenyl] 4-(dimethylamino)benzoate |
| SMILES | CCCCCCCCOc1ccc(/N=C/c2ccc(OC(=O)c3ccc(N(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H36N2O3/c1-4-5-6-7-8-9-22-34-28-20-14-26(15-21-28)31-23-24-10-18-29(19-11-24)35-30(33)25-12-16-27(17-13-25)32(2)3/h10-21,23H,4-9,22H2,1-3H3/b31-23+ |
| InChIKey | LLSUCUAPSGMMKB-UQRQXUALSA-N |
| XLogP | 7.46 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|