C32H40N2O3 — CID 101361123
[4-[[4-(dimethylamino)phenyl]methylideneamino]phenyl] 4-decoxybenzoate (PubChem CID 101361123) has the molecular formula C32H40N2O3 and a molecular weight of 500.68 g/mol. Its IUPAC name is [4-[[4-(dimethylamino)phenyl]methylideneamino]phenyl] 4-decoxybenzoate.
| Compound Name | [4-[[4-(dimethylamino)phenyl]methylideneamino]phenyl] 4-decoxybenzoate |
|---|---|
| PubChem CID | 101361123 |
| Molecular Formula | C32H40N2O3 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | [4-[[4-(dimethylamino)phenyl]methylideneamino]phenyl] 4-decoxybenzoate |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)Oc2ccc(/N=C/c3ccc(N(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H40N2O3/c1-4-5-6-7-8-9-10-11-24-36-30-20-14-27(15-21-30)32(35)37-31-22-16-28(17-23-31)33-25-26-12-18-29(19-13-26)34(2)3/h12-23,25H,4-11,24H2,1-3H3/b33-25+ |
| InChIKey | XRADXLINSFOFDY-INKHBPHZSA-N |
| XLogP | 8.24 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|