C28H31NO3 — CID 101016507
[4-[(4-butoxyphenyl)methylideneamino]phenyl] 4-tert-butylbenzoate (PubChem CID 101016507) has the molecular formula C28H31NO3 and a molecular weight of 429.56 g/mol. Its IUPAC name is [4-[(4-butoxyphenyl)methylideneamino]phenyl] 4-tert-butylbenzoate.
| Compound Name | [4-[(4-butoxyphenyl)methylideneamino]phenyl] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 101016507 |
| Molecular Formula | C28H31NO3 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | [4-[(4-butoxyphenyl)methylideneamino]phenyl] 4-tert-butylbenzoate |
| SMILES | CCCCOc1ccc(/C=N/c2ccc(OC(=O)c3ccc(C(C)(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H31NO3/c1-5-6-19-31-25-15-7-21(8-16-25)20-29-24-13-17-26(18-14-24)32-27(30)22-9-11-23(12-10-22)28(2,3)4/h7-18,20H,5-6,19H2,1-4H3/b29-20+ |
| InChIKey | MACDGLWCNKKTCV-ZTKZIYFRSA-N |
| XLogP | 7.13 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|