C47H60N2O6 — CID 101122145
[4-[[4-(10-hydroxydecoxy)phenyl]iminomethyl]phenyl] 4-[[4-(10-hydroxydecoxy)phenyl]iminomethyl]benzoate (PubChem CID 101122145) has the molecular formula C47H60N2O6 and a molecular weight of 749.01 g/mol. Its IUPAC name is [4-[[4-(10-hydroxydecoxy)phenyl]iminomethyl]phenyl] 4-[[4-(10-hydroxydecoxy)phenyl]iminomethyl]benzoate.
| Compound Name | [4-[[4-(10-hydroxydecoxy)phenyl]iminomethyl]phenyl] 4-[[4-(10-hydroxydecoxy)phenyl]iminomethyl]benzoate |
|---|---|
| PubChem CID | 101122145 |
| Molecular Formula | C47H60N2O6 |
| Molecular Weight | 749.01 g/mol |
| Exact Mass | 748.45 |
| IUPAC Name | [4-[[4-(10-hydroxydecoxy)phenyl]iminomethyl]phenyl] 4-[[4-(10-hydroxydecoxy)phenyl]iminomethyl]benzoate |
| SMILES | O=C(Oc1ccc(/C=N/c2ccc(OCCCCCCCCCCO)cc2)cc1)c1ccc(/C=N/c2ccc(OCCCCCCCCCCO)cc2)cc1 |
| InChI | InChI=1S/C47H60N2O6/c50-33-13-9-5-1-3-7-11-15-35-53-44-29-23-42(24-30-44)48-37-39-17-21-41(22-18-39)47(52)55-46-27-19-40(20-28-46)38-49-43-25-31-45(32-26-43)54-36-16-12-8-4-2-6-10-14-34-51/h17-32,37-38,50-51H,1-16,33-36H2/b48-37+,49-38+ |
| InChIKey | TTXGILJLNXTBSC-XWQCQBFISA-N |
| XLogP | 11.39 |
| TPSA | 109.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.01 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|