C29H31NO4 — CID 171158864
(3-formylphenyl) 4-[(4-octoxyphenyl)iminomethyl]benzoate (PubChem CID 171158864) has the molecular formula C29H31NO4 and a molecular weight of 457.57 g/mol. Its IUPAC name is (3-formylphenyl) 4-[(4-octoxyphenyl)iminomethyl]benzoate.
| Compound Name | (3-formylphenyl) 4-[(4-octoxyphenyl)iminomethyl]benzoate |
|---|---|
| PubChem CID | 171158864 |
| Molecular Formula | C29H31NO4 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | (3-formylphenyl) 4-[(4-octoxyphenyl)iminomethyl]benzoate |
| SMILES | CCCCCCCCOc1ccc(/N=C/c2ccc(C(=O)Oc3cccc(C=O)c3)cc2)cc1 |
| InChI | InChI=1S/C29H31NO4/c1-2-3-4-5-6-7-19-33-27-17-15-26(16-18-27)30-21-23-11-13-25(14-12-23)29(32)34-28-10-8-9-24(20-28)22-31/h8-18,20-22H,2-7,19H2,1H3/b30-21+ |
| InChIKey | WUKNPGCGNDCJQV-MWAVMZGNSA-N |
| XLogP | 7.21 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|