C59H67N5O6 — CID 102302521
[4-[(4-decoxyphenyl)diazenyl]phenyl] 3-[[4-[4-[(4-decoxyphenyl)diazenyl]phenoxy]carbonylphenyl]methylideneamino]benzoate (PubChem CID 102302521) has the molecular formula C59H67N5O6 and a molecular weight of 942.21 g/mol. Its IUPAC name is [4-[(4-decoxyphenyl)diazenyl]phenyl] 3-[[4-[4-[(4-decoxyphenyl)diazenyl]phenoxy]carbonylphenyl]methylideneamino]benzoate.
| Compound Name | [4-[(4-decoxyphenyl)diazenyl]phenyl] 3-[[4-[4-[(4-decoxyphenyl)diazenyl]phenoxy]carbonylphenyl]methylideneamino]benzoate |
|---|---|
| PubChem CID | 102302521 |
| Molecular Formula | C59H67N5O6 |
| Molecular Weight | 942.21 g/mol |
| Exact Mass | 941.51 |
| IUPAC Name | [4-[(4-decoxyphenyl)diazenyl]phenyl] 3-[[4-[4-[(4-decoxyphenyl)diazenyl]phenoxy]carbonylphenyl]methylideneamino]benzoate |
| SMILES | CCCCCCCCCCOc1ccc(/N=N/c2ccc(OC(=O)c3ccc(/C=N/c4cccc(C(=O)Oc5ccc(/N=N/c6ccc(OCCCCCCCCCC)cc6)cc5)c4)cc3)cc2)cc1 |
| InChI | InChI=1S/C59H67N5O6/c1-3-5-7-9-11-13-15-17-42-67-54-34-26-49(27-35-54)61-63-51-30-38-56(39-31-51)69-58(65)47-24-22-46(23-25-47)45-60-53-21-19-20-48(44-53)59(66)70-57-40-32-52(33-41-57)64-62-50-28-36-55(37-29-50)68-43-18-16-14-12-10-8-6-4-2/h19-41,44-45H,3-18,42-43H2,1-2H3/b60-45+,63-61+,64-62+ |
| InChIKey | LPGXVRBXFGORJN-HTJATBHLSA-N |
| XLogP | 17.75 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 942.21 |
| LogP ≤ 5 | 17.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|