C50H52N2O8 — CID 101121443
bis[4-[(4-heptoxycarbonylphenyl)methylideneamino]phenyl] benzene-1,3-dicarboxylate (PubChem CID 101121443) has the molecular formula C50H52N2O8 and a molecular weight of 808.97 g/mol. Its IUPAC name is bis[4-[(4-heptoxycarbonylphenyl)methylideneamino]phenyl] benzene-1,3-dicarboxylate.
| Compound Name | bis[4-[(4-heptoxycarbonylphenyl)methylideneamino]phenyl] benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 101121443 |
| Molecular Formula | C50H52N2O8 |
| Molecular Weight | 808.97 g/mol |
| Exact Mass | 808.37 |
| IUPAC Name | bis[4-[(4-heptoxycarbonylphenyl)methylideneamino]phenyl] benzene-1,3-dicarboxylate |
| SMILES | CCCCCCCOC(=O)c1ccc(/C=N/c2ccc(OC(=O)c3cccc(C(=O)Oc4ccc(/N=C/c5ccc(C(=O)OCCCCCCC)cc5)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C50H52N2O8/c1-3-5-7-9-11-32-57-47(53)39-20-16-37(17-21-39)35-51-43-24-28-45(29-25-43)59-49(55)41-14-13-15-42(34-41)50(56)60-46-30-26-44(27-31-46)52-36-38-18-22-40(23-19-38)48(54)58-33-12-10-8-6-4-2/h13-31,34-36H,3-12,32-33H2,1-2H3/b51-35+,52-36+ |
| InChIKey | VZFFIACUTAPNDJ-RSVFUAOESA-N |
| XLogP | 11.88 |
| TPSA | 129.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.97 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|