C26H25NO5 — CID 102267927
butyl 4-[[4-(4-methoxybenzoyl)oxyphenyl]methylideneamino]benzoate (PubChem CID 102267927) has the molecular formula C26H25NO5 and a molecular weight of 431.49 g/mol. Its IUPAC name is butyl 4-[[4-(4-methoxybenzoyl)oxyphenyl]methylideneamino]benzoate.
| Compound Name | butyl 4-[[4-(4-methoxybenzoyl)oxyphenyl]methylideneamino]benzoate |
|---|---|
| PubChem CID | 102267927 |
| Molecular Formula | C26H25NO5 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | butyl 4-[[4-(4-methoxybenzoyl)oxyphenyl]methylideneamino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(/N=C/c2ccc(OC(=O)c3ccc(OC)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H25NO5/c1-3-4-17-31-25(28)20-7-11-22(12-8-20)27-18-19-5-13-24(14-6-19)32-26(29)21-9-15-23(30-2)16-10-21/h5-16,18H,3-4,17H2,1-2H3/b27-18+ |
| InChIKey | OFGCSFMWEYBYAU-OVVQPSECSA-N |
| XLogP | 5.62 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|