C37H38N2O6 — CID 102594777
3-[4-[(4-propoxyphenyl)methylideneamino]benzoyl]oxypropyl 4-[(4-propoxyphenyl)methylideneamino]benzoate (PubChem CID 102594777) has the molecular formula C37H38N2O6 and a molecular weight of 606.72 g/mol. Its IUPAC name is 3-[4-[(4-propoxyphenyl)methylideneamino]benzoyl]oxypropyl 4-[(4-propoxyphenyl)methylideneamino]benzoate.
| Compound Name | 3-[4-[(4-propoxyphenyl)methylideneamino]benzoyl]oxypropyl 4-[(4-propoxyphenyl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 102594777 |
| Molecular Formula | C37H38N2O6 |
| Molecular Weight | 606.72 g/mol |
| Exact Mass | 606.27 |
| IUPAC Name | 3-[4-[(4-propoxyphenyl)methylideneamino]benzoyl]oxypropyl 4-[(4-propoxyphenyl)methylideneamino]benzoate |
| SMILES | CCCOc1ccc(/C=N/c2ccc(C(=O)OCCCOC(=O)c3ccc(/N=C/c4ccc(OCCC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H38N2O6/c1-3-22-42-34-18-6-28(7-19-34)26-38-32-14-10-30(11-15-32)36(40)44-24-5-25-45-37(41)31-12-16-33(17-13-31)39-27-29-8-20-35(21-9-29)43-23-4-2/h6-21,26-27H,3-5,22-25H2,1-2H3/b38-26+,39-27+ |
| InChIKey | JWMZNGJABYGASR-FGGILOIWSA-N |
| XLogP | 8.17 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.72 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|