C37H34N2O8 — CID 101120130
3-[4-[[4-(oxiran-2-ylmethoxy)phenyl]iminomethyl]benzoyl]oxypropyl 4-[[4-(oxiran-2-ylmethoxy)phenyl]iminomethyl]benzoate (PubChem CID 101120130) has the molecular formula C37H34N2O8 and a molecular weight of 634.69 g/mol. Its IUPAC name is 3-[4-[[4-(oxiran-2-ylmethoxy)phenyl]iminomethyl]benzoyl]oxypropyl 4-[[4-(oxiran-2-ylmethoxy)phenyl]iminomethyl]benzoate.
| Compound Name | 3-[4-[[4-(oxiran-2-ylmethoxy)phenyl]iminomethyl]benzoyl]oxypropyl 4-[[4-(oxiran-2-ylmethoxy)phenyl]iminomethyl]benzoate |
|---|---|
| PubChem CID | 101120130 |
| Molecular Formula | C37H34N2O8 |
| Molecular Weight | 634.69 g/mol |
| Exact Mass | 634.23 |
| IUPAC Name | 3-[4-[[4-(oxiran-2-ylmethoxy)phenyl]iminomethyl]benzoyl]oxypropyl 4-[[4-(oxiran-2-ylmethoxy)phenyl]iminomethyl]benzoate |
| SMILES | O=C(OCCCOC(=O)c1ccc(/C=N/c2ccc(OCC3CO3)cc2)cc1)c1ccc(/C=N/c2ccc(OCC3CO3)cc2)cc1 |
| InChI | InChI=1S/C37H34N2O8/c40-36(28-6-2-26(3-7-28)20-38-30-10-14-32(15-11-30)44-22-34-24-46-34)42-18-1-19-43-37(41)29-8-4-27(5-9-29)21-39-31-12-16-33(17-13-31)45-23-35-25-47-35/h2-17,20-21,34-35H,1,18-19,22-25H2/b38-20+,39-21+ |
| InChIKey | ZPMMVOGGUSKAAQ-DAGCGWHASA-N |
| XLogP | 6.15 |
| TPSA | 120.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.69 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|