C40H40N2O10 — CID 101238916
2-[2-[2-[4-[[4-(oxiran-2-ylmethoxy)phenyl]iminomethyl]benzoyl]oxyethoxy]ethoxy]ethyl 4-[[4-(oxiran-2-ylmethoxy)phenyl]iminomethyl]benzoate (PubChem CID 101238916) has the molecular formula C40H40N2O10 and a molecular weight of 708.76 g/mol. Its IUPAC name is 2-[2-[2-[4-[[4-(oxiran-2-ylmethoxy)phenyl]iminomethyl]benzoyl]oxyethoxy]ethoxy]ethyl 4-[[4-(oxiran-2-ylmethoxy)phenyl]iminomethyl]benzoate.
| Compound Name | 2-[2-[2-[4-[[4-(oxiran-2-ylmethoxy)phenyl]iminomethyl]benzoyl]oxyethoxy]ethoxy]ethyl 4-[[4-(oxiran-2-ylmethoxy)phenyl]iminomethyl]benzoate |
|---|---|
| PubChem CID | 101238916 |
| Molecular Formula | C40H40N2O10 |
| Molecular Weight | 708.76 g/mol |
| Exact Mass | 708.27 |
| IUPAC Name | 2-[2-[2-[4-[[4-(oxiran-2-ylmethoxy)phenyl]iminomethyl]benzoyl]oxyethoxy]ethoxy]ethyl 4-[[4-(oxiran-2-ylmethoxy)phenyl]iminomethyl]benzoate |
| SMILES | O=C(OCCOCCOCCOC(=O)c1ccc(/C=N/c2ccc(OCC3CO3)cc2)cc1)c1ccc(/C=N/c2ccc(OCC3CO3)cc2)cc1 |
| InChI | InChI=1S/C40H40N2O10/c43-39(31-5-1-29(2-6-31)23-41-33-9-13-35(14-10-33)49-25-37-27-51-37)47-21-19-45-17-18-46-20-22-48-40(44)32-7-3-30(4-8-32)24-42-34-11-15-36(16-12-34)50-26-38-28-52-38/h1-16,23-24,37-38H,17-22,25-28H2/b41-23+,42-24+ |
| InChIKey | ITHQNJBLVYHGCQ-WAJJMWJGSA-N |
| XLogP | 5.79 |
| TPSA | 139.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.76 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|