C14H16O4 — CID 159138590
cyclopropylmethyl 4-(oxiran-2-ylmethoxy)benzoate (PubChem CID 159138590) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is cyclopropylmethyl 4-(oxiran-2-ylmethoxy)benzoate.
| Compound Name | cyclopropylmethyl 4-(oxiran-2-ylmethoxy)benzoate |
|---|---|
| PubChem CID | 159138590 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | cyclopropylmethyl 4-(oxiran-2-ylmethoxy)benzoate |
| SMILES | O=C(OCC1CC1)c1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C14H16O4/c15-14(18-7-10-1-2-10)11-3-5-12(6-4-11)16-8-13-9-17-13/h3-6,10,13H,1-2,7-9H2 |
| InChIKey | BJCQNNZPCZSJBL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|