C20H18O7 — CID 56615855
oxiran-2-ylmethyl 4-[4-(oxiran-2-ylmethoxycarbonyl)phenoxy]benzoate (PubChem CID 56615855) has the molecular formula C20H18O7 and a molecular weight of 370.36 g/mol. Its IUPAC name is oxiran-2-ylmethyl 4-[4-(oxiran-2-ylmethoxycarbonyl)phenoxy]benzoate.
| Compound Name | oxiran-2-ylmethyl 4-[4-(oxiran-2-ylmethoxycarbonyl)phenoxy]benzoate |
|---|---|
| PubChem CID | 56615855 |
| Molecular Formula | C20H18O7 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | oxiran-2-ylmethyl 4-[4-(oxiran-2-ylmethoxycarbonyl)phenoxy]benzoate |
| SMILES | O=C(OCC1CO1)c1ccc(Oc2ccc(C(=O)OCC3CO3)cc2)cc1 |
| InChI | InChI=1S/C20H18O7/c21-19(25-11-17-9-23-17)13-1-5-15(6-2-13)27-16-7-3-14(4-8-16)20(22)26-12-18-10-24-18/h1-8,17-18H,9-12H2 |
| InChIKey | LLLGQQJEEOPXAY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 86.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|