C16H18O6 — CID 155453397
1-O-[2-(2-hydroxycyclopropyl)ethyl] 4-O-(oxiran-2-ylmethyl) benzene-1,4-dicarboxylate (PubChem CID 155453397) has the molecular formula C16H18O6 and a molecular weight of 306.31 g/mol. Its IUPAC name is 1-O-[2-(2-hydroxycyclopropyl)ethyl] 4-O-(oxiran-2-ylmethyl) benzene-1,4-dicarboxylate.
| Compound Name | 1-O-[2-(2-hydroxycyclopropyl)ethyl] 4-O-(oxiran-2-ylmethyl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 155453397 |
| Molecular Formula | C16H18O6 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 1-O-[2-(2-hydroxycyclopropyl)ethyl] 4-O-(oxiran-2-ylmethyl) benzene-1,4-dicarboxylate |
| SMILES | O=C(OCCC1CC1O)c1ccc(C(=O)OCC2CO2)cc1 |
| InChI | InChI=1S/C16H18O6/c17-14-7-12(14)5-6-20-15(18)10-1-3-11(4-2-10)16(19)22-9-13-8-21-13/h1-4,12-14,17H,5-9H2 |
| InChIKey | WHUIUCTUHIJLFF-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|