C15H16O5 — CID 165037318
1-O-(cyclopropylmethyl) 3-O-(oxiran-2-ylmethyl) benzene-1,3-dicarboxylate (PubChem CID 165037318) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is 1-O-(cyclopropylmethyl) 3-O-(oxiran-2-ylmethyl) benzene-1,3-dicarboxylate.
| Compound Name | 1-O-(cyclopropylmethyl) 3-O-(oxiran-2-ylmethyl) benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 165037318 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 1-O-(cyclopropylmethyl) 3-O-(oxiran-2-ylmethyl) benzene-1,3-dicarboxylate |
| SMILES | O=C(OCC1CC1)c1cccc(C(=O)OCC2CO2)c1 |
| InChI | InChI=1S/C15H16O5/c16-14(19-7-10-4-5-10)11-2-1-3-12(6-11)15(17)20-9-13-8-18-13/h1-3,6,10,13H,4-5,7-9H2 |
| InChIKey | PMYKIYIBGPBOBD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|