C14H16O6 — CID 129194834
1-O-(3-hydroxypropyl) 3-O-(oxiran-2-ylmethyl) benzene-1,3-dicarboxylate (PubChem CID 129194834) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is 1-O-(3-hydroxypropyl) 3-O-(oxiran-2-ylmethyl) benzene-1,3-dicarboxylate.
| Compound Name | 1-O-(3-hydroxypropyl) 3-O-(oxiran-2-ylmethyl) benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 129194834 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 1-O-(3-hydroxypropyl) 3-O-(oxiran-2-ylmethyl) benzene-1,3-dicarboxylate |
| SMILES | O=C(OCCCO)c1cccc(C(=O)OCC2CO2)c1 |
| InChI | InChI=1S/C14H16O6/c15-5-2-6-18-13(16)10-3-1-4-11(7-10)14(17)20-9-12-8-19-12/h1,3-4,7,12,15H,2,5-6,8-9H2 |
| InChIKey | GANBZOBHLLFJDZ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|