C59H90O9 — CID 59821408
1-O-[8-[3,6-diheptyl-2-[10-[3-(oxiran-2-ylmethoxycarbonyl)phenyl]-10-oxodecyl]cyclohexyl]octyl] 3-O-(oxiran-2-ylmethyl) benzene-1,3-dicarboxylate (PubChem CID 59821408) has the molecular formula C59H90O9 and a molecular weight of 943.36 g/mol. Its IUPAC name is 1-O-[8-[3,6-diheptyl-2-[10-[3-(oxiran-2-ylmethoxycarbonyl)phenyl]-10-oxodecyl]cyclohexyl]octyl] 3-O-(oxiran-2-ylmethyl) benzene-1,3-dicarboxylate.
| Compound Name | 1-O-[8-[3,6-diheptyl-2-[10-[3-(oxiran-2-ylmethoxycarbonyl)phenyl]-10-oxodecyl]cyclohexyl]octyl] 3-O-(oxiran-2-ylmethyl) benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 59821408 |
| Molecular Formula | C59H90O9 |
| Molecular Weight | 943.36 g/mol |
| Exact Mass | 942.66 |
| IUPAC Name | 1-O-[8-[3,6-diheptyl-2-[10-[3-(oxiran-2-ylmethoxycarbonyl)phenyl]-10-oxodecyl]cyclohexyl]octyl] 3-O-(oxiran-2-ylmethyl) benzene-1,3-dicarboxylate |
| SMILES | CCCCCCCC1CCC(CCCCCCC)C(CCCCCCCCOC(=O)c2cccc(C(=O)OCC3CO3)c2)C1CCCCCCCCCC(=O)c1cccc(C(=O)OCC2CO2)c1 |
| InChI | InChI=1S/C59H90O9/c1-3-5-7-14-20-28-46-37-38-47(29-21-15-8-6-4-2)55(35-23-17-12-13-19-25-39-64-57(61)50-32-27-33-51(41-50)59(63)68-45-53-43-66-53)54(46)34-22-16-10-9-11-18-24-36-56(60)48-30-26-31-49(40-48)58(62)67-44-52-42-65-52/h26-27,30-33,40-41,46-47,52-55H,3-25,28-29,34-39,42-45H2,1-2H3 |
| InChIKey | ZOPLGAQCRKAJER-UHFFFAOYSA-N |
| XLogP | 15.06 |
| TPSA | 121.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.36 |
| LogP ≤ 5 | 15.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|