C20H20O9 — CID 134476833
tris(oxiran-2-ylmethyl) bicyclo[4.2.0]octa-1(6),2,4-triene-3,7,8-tricarboxylate (PubChem CID 134476833) has the molecular formula C20H20O9 and a molecular weight of 404.37 g/mol. Its IUPAC name is tris(oxiran-2-ylmethyl) bicyclo[4.2.0]octa-1(6),2,4-triene-3,7,8-tricarboxylate.
| Compound Name | tris(oxiran-2-ylmethyl) bicyclo[4.2.0]octa-1(6),2,4-triene-3,7,8-tricarboxylate |
|---|---|
| PubChem CID | 134476833 |
| Molecular Formula | C20H20O9 |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | tris(oxiran-2-ylmethyl) bicyclo[4.2.0]octa-1(6),2,4-triene-3,7,8-tricarboxylate |
| SMILES | O=C(OCC1CO1)c1ccc2c(c1)C(C(=O)OCC1CO1)C2C(=O)OCC1CO1 |
| InChI | InChI=1S/C20H20O9/c21-18(27-7-11-4-24-11)10-1-2-14-15(3-10)17(20(23)29-9-13-6-26-13)16(14)19(22)28-8-12-5-25-12/h1-3,11-13,16-17H,4-9H2 |
| InChIKey | IZGVBNLKYNVHNP-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 116.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|