C13H10O9 — CID 153325311
5-(oxiran-2-ylmethoxycarbonyl)benzene-1,2,4-tricarboxylic acid (PubChem CID 153325311) has the molecular formula C13H10O9 and a molecular weight of 310.21 g/mol. Its IUPAC name is 5-(oxiran-2-ylmethoxycarbonyl)benzene-1,2,4-tricarboxylic acid.
| Compound Name | 5-(oxiran-2-ylmethoxycarbonyl)benzene-1,2,4-tricarboxylic acid |
|---|---|
| PubChem CID | 153325311 |
| Molecular Formula | C13H10O9 |
| Molecular Weight | 310.21 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 5-(oxiran-2-ylmethoxycarbonyl)benzene-1,2,4-tricarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)c(C(=O)OCC2CO2)cc1C(=O)O |
| InChI | InChI=1S/C13H10O9/c14-10(15)6-1-8(12(18)19)9(2-7(6)11(16)17)13(20)22-4-5-3-21-5/h1-2,5H,3-4H2,(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | NQHXQSVHYGSSMH-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 150.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.21 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|