About oxiran-2-ylmethyl 2-[2-(oxiran-2-ylmethoxycarbonyl)phenyl]benzoate
oxiran-2-ylmethyl 2-[2-(oxiran-2-ylmethoxycarbonyl)phenyl]benzoate (PubChem CID 22600264) has the molecular formula C20H18O6
and a molecular weight of 354.36 g/mol. Its IUPAC name is oxiran-2-ylmethyl 2-[2-(oxiran-2-ylmethoxycarbonyl)phenyl]benzoate.
Molecular Properties
| Compound Name | oxiran-2-ylmethyl 2-[2-(oxiran-2-ylmethoxycarbonyl)phenyl]benzoate |
| PubChem CID | 22600264 |
| Molecular Formula | C20H18O6 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | oxiran-2-ylmethyl 2-[2-(oxiran-2-ylmethoxycarbonyl)phenyl]benzoate |
| SMILES | O=C(OCC1CO1)c1ccccc1-c1ccccc1C(=O)OCC1CO1 |
| InChI | InChI=1S/C20H18O6/c21-19(25-11-13-9-23-13)17-7-3-1-5-15(17)16-6-2-4-8-18(16)20(22)26-12-14-10-24-14/h1-8,13-14H,9-12H2 |
| InChIKey | NCJZAWJBYUFLIW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 77.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze oxiran-2-ylmethyl 2-[2-(oxiran-2-ylmethoxycarbonyl)phenyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxiran-2-ylmethyl 2-[2-(oxiran-2-ylmethoxycarbonyl)phenyl]benzoate?
The IUPAC name of oxiran-2-ylmethyl 2-[2-(oxiran-2-ylmethoxycarbonyl)phenyl]benzoate (CID 22600264) is oxiran-2-ylmethyl 2-[2-(oxiran-2-ylmethoxycarbonyl)phenyl]benzoate.
What is the SMILES notation for oxiran-2-ylmethyl 2-[2-(oxiran-2-ylmethoxycarbonyl)phenyl]benzoate?
The canonical SMILES for oxiran-2-ylmethyl 2-[2-(oxiran-2-ylmethoxycarbonyl)phenyl]benzoate is O=C(OCC1CO1)c1ccccc1-c1ccccc1C(=O)OCC1CO1.
What is the InChIKey of oxiran-2-ylmethyl 2-[2-(oxiran-2-ylmethoxycarbonyl)phenyl]benzoate?
The InChIKey is NCJZAWJBYUFLIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18O6/c21-19(25-11-13-9-23-13)17-7-3-1-5-15(17)16-6-2-4-8-18(16)20(22)26-12-14-10-24-14/h1-8,13-14H,9-12H2.
What are the key properties of oxiran-2-ylmethyl 2-[2-(oxiran-2-ylmethoxycarbonyl)phenyl]benzoate?
oxiran-2-ylmethyl 2-[2-(oxiran-2-ylmethoxycarbonyl)phenyl]benzoate has a molecular weight of 354.36 g/mol, XLogP of 2.46, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for oxiran-2-ylmethyl 2-[2-(oxiran-2-ylmethoxycarbonyl)phenyl]benzoate is sourced from PubChem (CID 22600264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).