C14H10O7 — CID 139755522
oxiran-2-ylmethyl (3Z)-1,6-dioxo-2,5-benzodioxocine-4-carboxylate (PubChem CID 139755522) has the molecular formula C14H10O7 and a molecular weight of 290.23 g/mol. Its IUPAC name is oxiran-2-ylmethyl (3Z)-1,6-dioxo-2,5-benzodioxocine-4-carboxylate.
| Compound Name | oxiran-2-ylmethyl (3Z)-1,6-dioxo-2,5-benzodioxocine-4-carboxylate |
|---|---|
| PubChem CID | 139755522 |
| Molecular Formula | C14H10O7 |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | oxiran-2-ylmethyl (3Z)-1,6-dioxo-2,5-benzodioxocine-4-carboxylate |
| SMILES | O=C(OCC1CO1)/C1=C/OC(=O)c2ccccc2C(=O)O1 |
| InChI | InChI=1S/C14H10O7/c15-12-9-3-1-2-4-10(9)13(16)21-11(7-20-12)14(17)19-6-8-5-18-8/h1-4,7-8H,5-6H2/b11-7- |
| InChIKey | KZYIIIPYEYBNNO-XFFZJAGNSA-N |
| XLogP | 0.80 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|