C19H18O11 — CID 18705392
2,4,5-tris(oxiran-2-ylmethoxycarbonyl)benzoic acid (PubChem CID 18705392) has the molecular formula C19H18O11 and a molecular weight of 422.34 g/mol. Its IUPAC name is 2,4,5-tris(oxiran-2-ylmethoxycarbonyl)benzoic acid.
| Compound Name | 2,4,5-tris(oxiran-2-ylmethoxycarbonyl)benzoic acid |
|---|---|
| PubChem CID | 18705392 |
| Molecular Formula | C19H18O11 |
| Molecular Weight | 422.34 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 2,4,5-tris(oxiran-2-ylmethoxycarbonyl)benzoic acid |
| SMILES | O=C(O)c1cc(C(=O)OCC2CO2)c(C(=O)OCC2CO2)cc1C(=O)OCC1CO1 |
| InChI | InChI=1S/C19H18O11/c20-16(21)12-1-14(18(23)29-7-10-4-26-10)15(19(24)30-8-11-5-27-11)2-13(12)17(22)28-6-9-3-25-9/h1-2,9-11H,3-8H2,(H,20,21) |
| InChIKey | DEJSZHIRXWUGQS-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 153.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.34 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|