C14H13NO8 — CID 87281888
bis(oxiran-2-ylmethyl) 2-nitrobenzene-1,4-dicarboxylate (PubChem CID 87281888) has the molecular formula C14H13NO8 and a molecular weight of 323.26 g/mol. Its IUPAC name is bis(oxiran-2-ylmethyl) 2-nitrobenzene-1,4-dicarboxylate.
| Compound Name | bis(oxiran-2-ylmethyl) 2-nitrobenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 87281888 |
| Molecular Formula | C14H13NO8 |
| Molecular Weight | 323.26 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | bis(oxiran-2-ylmethyl) 2-nitrobenzene-1,4-dicarboxylate |
| SMILES | O=C(OCC1CO1)c1ccc(C(=O)OCC2CO2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H13NO8/c16-13(22-6-9-4-20-9)8-1-2-11(12(3-8)15(18)19)14(17)23-7-10-5-21-10/h1-3,9-10H,4-7H2 |
| InChIKey | DPSKVTZHJLUSAN-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 120.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.26 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|