C17H15NO6S — CID 7678537
[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl 4-methylsulfanyl-3-nitrobenzoate (PubChem CID 7678537) has the molecular formula C17H15NO6S and a molecular weight of 361.38 g/mol. Its IUPAC name is [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl 4-methylsulfanyl-3-nitrobenzoate.
| Compound Name | [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl 4-methylsulfanyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 7678537 |
| Molecular Formula | C17H15NO6S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl 4-methylsulfanyl-3-nitrobenzoate |
| SMILES | CSc1ccc(C(=O)OC[C@@H]2COc3ccccc3O2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H15NO6S/c1-25-16-7-6-11(8-13(16)18(20)21)17(19)23-10-12-9-22-14-4-2-3-5-15(14)24-12/h2-8,12H,9-10H2,1H3/t12-/m0/s1 |
| InChIKey | UAXSAWHVQJPRSJ-LBPRGKRZSA-N |
| XLogP | 3.31 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|