C19H15Cl2NO5S — CID 16959890
(2,2-dichlorocyclopropyl)methyl 2-(4-methylsulfanyl-3-nitrobenzoyl)benzoate (PubChem CID 16959890) has the molecular formula C19H15Cl2NO5S and a molecular weight of 440.30 g/mol. Its IUPAC name is (2,2-dichlorocyclopropyl)methyl 2-(4-methylsulfanyl-3-nitrobenzoyl)benzoate.
| Compound Name | (2,2-dichlorocyclopropyl)methyl 2-(4-methylsulfanyl-3-nitrobenzoyl)benzoate |
|---|---|
| PubChem CID | 16959890 |
| Molecular Formula | C19H15Cl2NO5S |
| Molecular Weight | 440.30 g/mol |
| Exact Mass | 439.00 |
| IUPAC Name | (2,2-dichlorocyclopropyl)methyl 2-(4-methylsulfanyl-3-nitrobenzoyl)benzoate |
| SMILES | CSc1ccc(C(=O)c2ccccc2C(=O)OCC2CC2(Cl)Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H15Cl2NO5S/c1-28-16-7-6-11(8-15(16)22(25)26)17(23)13-4-2-3-5-14(13)18(24)27-10-12-9-19(12,20)21/h2-8,12H,9-10H2,1H3 |
| InChIKey | VBTLHCXSLSWMGB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.30 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|