C26H24N2O6S — CID 42983727
[2-[1-(2-methylphenyl)ethylamino]-2-oxoethyl] 2-(4-methylsulfanyl-3-nitrobenzoyl)benzoate (PubChem CID 42983727) has the molecular formula C26H24N2O6S and a molecular weight of 492.55 g/mol. Its IUPAC name is [2-[1-(2-methylphenyl)ethylamino]-2-oxoethyl] 2-(4-methylsulfanyl-3-nitrobenzoyl)benzoate.
| Compound Name | [2-[1-(2-methylphenyl)ethylamino]-2-oxoethyl] 2-(4-methylsulfanyl-3-nitrobenzoyl)benzoate |
|---|---|
| PubChem CID | 42983727 |
| Molecular Formula | C26H24N2O6S |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | [2-[1-(2-methylphenyl)ethylamino]-2-oxoethyl] 2-(4-methylsulfanyl-3-nitrobenzoyl)benzoate |
| SMILES | CSc1ccc(C(=O)c2ccccc2C(=O)OCC(=O)NC(C)c2ccccc2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H24N2O6S/c1-16-8-4-5-9-19(16)17(2)27-24(29)15-34-26(31)21-11-7-6-10-20(21)25(30)18-12-13-23(35-3)22(14-18)28(32)33/h4-14,17H,15H2,1-3H3,(H,27,29) |
| InChIKey | UFAGOLBSTDZALO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|