C19H19NO5S — CID 7654989
[2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 4-methylsulfanyl-3-nitrobenzoate (PubChem CID 7654989) has the molecular formula C19H19NO5S and a molecular weight of 373.43 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 4-methylsulfanyl-3-nitrobenzoate.
| Compound Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 4-methylsulfanyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 7654989 |
| Molecular Formula | C19H19NO5S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 4-methylsulfanyl-3-nitrobenzoate |
| SMILES | CSc1ccc(C(=O)OCC(=O)c2cc(C)c(C)cc2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H19NO5S/c1-11-7-13(3)15(8-12(11)2)17(21)10-25-19(22)14-5-6-18(26-4)16(9-14)20(23)24/h5-9H,10H2,1-4H3 |
| InChIKey | KQUIMUAJSCCTTD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|