C19H19NO5 — CID 2488807
[2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 3-methyl-4-nitrobenzoate (PubChem CID 2488807) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 3-methyl-4-nitrobenzoate.
| Compound Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 3-methyl-4-nitrobenzoate |
|---|---|
| PubChem CID | 2488807 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 3-methyl-4-nitrobenzoate |
| SMILES | Cc1cc(C)c(C(=O)COC(=O)c2ccc([N+](=O)[O-])c(C)c2)cc1C |
| InChI | InChI=1S/C19H19NO5/c1-11-7-13(3)16(9-12(11)2)18(21)10-25-19(22)15-5-6-17(20(23)24)14(4)8-15/h5-9H,10H2,1-4H3 |
| InChIKey | NFFXZKXOWBECLM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|