C18H18O4 — CID 2624699
[2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 4-hydroxybenzoate (PubChem CID 2624699) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 4-hydroxybenzoate.
| Compound Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 4-hydroxybenzoate |
|---|---|
| PubChem CID | 2624699 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 4-hydroxybenzoate |
| SMILES | Cc1cc(C)c(C(=O)COC(=O)c2ccc(O)cc2)cc1C |
| InChI | InChI=1S/C18H18O4/c1-11-8-13(3)16(9-12(11)2)17(20)10-22-18(21)14-4-6-15(19)7-5-14/h4-9,19H,10H2,1-3H3 |
| InChIKey | MFSFDOJYYRTNCW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |