C20H22O3 — CID 2519588
[2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 2,5-dimethylbenzoate (PubChem CID 2519588) has the molecular formula C20H22O3 and a molecular weight of 310.39 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 2,5-dimethylbenzoate.
| Compound Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 2,5-dimethylbenzoate |
|---|---|
| PubChem CID | 2519588 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 2,5-dimethylbenzoate |
| SMILES | Cc1ccc(C)c(C(=O)OCC(=O)c2cc(C)c(C)cc2C)c1 |
| InChI | InChI=1S/C20H22O3/c1-12-6-7-13(2)18(8-12)20(22)23-11-19(21)17-10-15(4)14(3)9-16(17)5/h6-10H,11H2,1-5H3 |
| InChIKey | KNXNJRJJZSFWSP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |