C24H24O6 — CID 46803606
bis[2-(2,5-dimethylphenyl)-2-oxoethyl] (E)-but-2-enedioate (PubChem CID 46803606) has the molecular formula C24H24O6 and a molecular weight of 408.45 g/mol. Its IUPAC name is bis[2-(2,5-dimethylphenyl)-2-oxoethyl] (E)-but-2-enedioate.
| Compound Name | bis[2-(2,5-dimethylphenyl)-2-oxoethyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 46803606 |
| Molecular Formula | C24H24O6 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | bis[2-(2,5-dimethylphenyl)-2-oxoethyl] (E)-but-2-enedioate |
| SMILES | Cc1ccc(C)c(C(=O)COC(=O)/C=C/C(=O)OCC(=O)c2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C24H24O6/c1-15-5-7-17(3)19(11-15)21(25)13-29-23(27)9-10-24(28)30-14-22(26)20-12-16(2)6-8-18(20)4/h5-12H,13-14H2,1-4H3/b10-9+ |
| InChIKey | XDITULQSMPAUBN-MDZDMXLPSA-N |
| XLogP | 3.63 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|