C17H15ClO3 — CID 882294
[2-(2,5-dimethylphenyl)-2-oxoethyl] 4-chlorobenzoate (PubChem CID 882294) has the molecular formula C17H15ClO3 and a molecular weight of 302.76 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)-2-oxoethyl] 4-chlorobenzoate.
| Compound Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 882294 |
| Molecular Formula | C17H15ClO3 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 4-chlorobenzoate |
| SMILES | Cc1ccc(C)c(C(=O)COC(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C17H15ClO3/c1-11-3-4-12(2)15(9-11)16(19)10-21-17(20)13-5-7-14(18)8-6-13/h3-9H,10H2,1-2H3 |
| InChIKey | UCJKEKLQRBWILY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |