C18H18O5S — CID 2668944
[2-(2,5-dimethylphenyl)-2-oxoethyl] 4-methylsulfonylbenzoate (PubChem CID 2668944) has the molecular formula C18H18O5S and a molecular weight of 346.40 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)-2-oxoethyl] 4-methylsulfonylbenzoate.
| Compound Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 4-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 2668944 |
| Molecular Formula | C18H18O5S |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 4-methylsulfonylbenzoate |
| SMILES | Cc1ccc(C)c(C(=O)COC(=O)c2ccc(S(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C18H18O5S/c1-12-4-5-13(2)16(10-12)17(19)11-23-18(20)14-6-8-15(9-7-14)24(3,21)22/h4-10H,11H2,1-3H3 |
| InChIKey | KWQAUBRHQPNZBD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |