C16H14ClNO3 — CID 2515362
[2-(2,5-dimethylphenyl)-2-oxoethyl] 2-chloropyridine-3-carboxylate (PubChem CID 2515362) has the molecular formula C16H14ClNO3 and a molecular weight of 303.75 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-chloropyridine-3-carboxylate.
| Compound Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 2515362 |
| Molecular Formula | C16H14ClNO3 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-chloropyridine-3-carboxylate |
| SMILES | Cc1ccc(C)c(C(=O)COC(=O)c2cccnc2Cl)c1 |
| InChI | InChI=1S/C16H14ClNO3/c1-10-5-6-11(2)13(8-10)14(19)9-21-16(20)12-4-3-7-18-15(12)17/h3-8H,9H2,1-2H3 |
| InChIKey | UMHBYIMLVPPZHY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|