C18H15F3O3 — CID 8894072
[2-(2,5-dimethylphenyl)-2-oxoethyl] 2-(trifluoromethyl)benzoate (PubChem CID 8894072) has the molecular formula C18H15F3O3 and a molecular weight of 336.31 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-(trifluoromethyl)benzoate.
| Compound Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 8894072 |
| Molecular Formula | C18H15F3O3 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-(trifluoromethyl)benzoate |
| SMILES | Cc1ccc(C)c(C(=O)COC(=O)c2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C18H15F3O3/c1-11-7-8-12(2)14(9-11)16(22)10-24-17(23)13-5-3-4-6-15(13)18(19,20)21/h3-9H,10H2,1-2H3 |
| InChIKey | QMZSSWAUCHOZPG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |